Products 1337505-78-8
CAS 1337505-78-8 is the registry number for 4,4,5,5-Tetramethyl-2-(2,4,5-trimethylphenyl)-1,3,2-dioxaborolane, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-(2,4,5-trimethylphenyl)-1,3,2-dioxaborolane (CAS 1337505-78-8) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,4,5-trimethylphenyl)-1,3,2-dioxaborolane. InChIKey: WXVQNHZAYIRIJN-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,4,5-trimethylphenyl)-1,3,2-dioxaborolane |
| InChIKey | WXVQNHZAYIRIJN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C)C)C |
Computed by PubChem (NCBI)