CAS 133756-29-3 is the registry number for 1,2,3,4,5,6-Hexa(pyridin-4-yl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3,4,5,6-pentapyridin-4-ylphenyl)pyridine (CAS 133756-29-3) is a chemical compound with the molecular formula C36H24N6 and a molecular weight of 540.6 g/mol. IUPAC name: 4-(2,3,4,5,6-pentapyridin-4-ylphenyl)pyridine. InChIKey: BWFJBBWGMZNHCW-UHFFFAOYSA-N.
| Molecular formula | C36H24N6 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | 4-(2,3,4,5,6-pentapyridin-4-ylphenyl)pyridine |
| InChIKey | BWFJBBWGMZNHCW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=C(C(=C(C(=C2C3=CC=NC=C3)C4=CC=NC=C4)C5=CC=NC=C5)C6=CC=NC=C6)C7=CC=NC=C7 |
Computed by PubChem (NCBI)