CAS 170165-86-3 is the registry number for 2,4,6-Tris(4-(pyridin-4-yl)phenyl)-1,3,5-triazine. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4,6-tris(4-pyridin-4-ylphenyl)-1,3,5-triazine (CAS 170165-86-3) is a chemical compound with the molecular formula C36H24N6 and a molecular weight of 540.6 g/mol. IUPAC name: 2,4,6-tris(4-pyridin-4-ylphenyl)-1,3,5-triazine. InChIKey: LHJMPIWSRSPJBO-UHFFFAOYSA-N.
| Molecular formula | C36H24N6 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | 2,4,6-tris(4-pyridin-4-ylphenyl)-1,3,5-triazine |
| InChIKey | LHJMPIWSRSPJBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)C3=NC(=NC(=N3)C4=CC=C(C=C4)C5=CC=NC=C5)C6=CC=C(C=C6)C7=CC=NC=C7 |
Computed by PubChem (NCBI)