Products 921205-13-2
CAS 921205-13-2 is the registry number for 5,5'-(5'-(3-(Pyrimidin-5-yl)phenyl)-[1,1':3',1''-terphenyl]-3,3''-diyl)dipyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[3-[3,5-bis(3-pyrimidin-5-ylphenyl)phenyl]phenyl]pyrimidine (CAS 921205-13-2) is a chemical compound with the molecular formula C36H24N6 and a molecular weight of 540.6 g/mol. IUPAC name: 5-[3-[3,5-bis(3-pyrimidin-5-ylphenyl)phenyl]phenyl]pyrimidine. InChIKey: SQRVPOVZGDZMLA-UHFFFAOYSA-N.
| Molecular formula | C36H24N6 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | 5-[3-[3,5-bis(3-pyrimidin-5-ylphenyl)phenyl]phenyl]pyrimidine |
| InChIKey | SQRVPOVZGDZMLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CN=CN=C2)C3=CC(=CC(=C3)C4=CC(=CC=C4)C5=CN=CN=C5)C6=CC(=CC=C6)C7=CN=CN=C7 |
Computed by PubChem (NCBI)