CAS 1337879-85-2 is the registry number for 8-Bromoisoquinolin-1-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
8-bromoisoquinolin-1-amine (CAS 1337879-85-2) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 8-bromoisoquinolin-1-amine. InChIKey: VEHRKMAFAWPXEB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 8-bromoisoquinolin-1-amine |
| InChIKey | VEHRKMAFAWPXEB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=NC=C2)N |
Computed by PubChem (NCBI)