Products 1338050-96-6

CAS 1338050-96-6 is the registry number for Ethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate (CAS 1338050-96-6) is a chemical compound with the molecular formula C9H9BrN4O2 and a molecular weight of 285.10 g/mol. IUPAC name: ethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate. InChIKey: AZIOKLMLGQRHEY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrN4O2
Molecular weight285.10 g/mol
IUPAC nameethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate
InChIKeyAZIOKLMLGQRHEY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2C(=NC=NN2C(=C1)Br)N

Computed by PubChem (NCBI)