CAS 1338050-96-6 is the registry number for Ethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate (CAS 1338050-96-6) is a chemical compound with the molecular formula C9H9BrN4O2 and a molecular weight of 285.10 g/mol. IUPAC name: ethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate. InChIKey: AZIOKLMLGQRHEY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN4O2 |
|---|---|
| Molecular weight | 285.10 g/mol |
| IUPAC name | ethyl 4-amino-7-bromopyrrolo[2,1-f][1,2,4]triazine-5-carboxylate |
| InChIKey | AZIOKLMLGQRHEY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=NC=NN2C(=C1)Br)N |
Computed by PubChem (NCBI)