CAS 1510311-17-7 is the registry number for 5-Bromo-2-methyl-3-((3-methyl-1,2,4-oxadiazol-5-yl)methyl)-3,4-dihydropyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrimidin-4-one (CAS 1510311-17-7) is a chemical compound with the molecular formula C9H9BrN4O2 and a molecular weight of 285.10 g/mol. IUPAC name: 5-bromo-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrimidin-4-one. InChIKey: CKWRIOCZAQTWTH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN4O2 |
|---|---|
| Molecular weight | 285.10 g/mol |
| IUPAC name | 5-bromo-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrimidin-4-one |
| InChIKey | CKWRIOCZAQTWTH-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CN2C(=NC=C(C2=O)Br)C |
Computed by PubChem (NCBI)