Products 2633725-79-6
CAS 2633725-79-6 is the registry number for 1-((5-Bromopyrimidin-2-yl)methyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(5-bromopyrimidin-2-yl)methyl]-1,3-diazinane-2,4-dione (CAS 2633725-79-6) is a chemical compound with the molecular formula C9H9BrN4O2 and a molecular weight of 285.10 g/mol. IUPAC name: 1-[(5-bromopyrimidin-2-yl)methyl]-1,3-diazinane-2,4-dione. InChIKey: RHXDHIXQOMEPFR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN4O2 |
|---|---|
| Molecular weight | 285.10 g/mol |
| IUPAC name | 1-[(5-bromopyrimidin-2-yl)methyl]-1,3-diazinane-2,4-dione |
| InChIKey | RHXDHIXQOMEPFR-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)CC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)