CAS 1338070-96-4 is the registry number for 1,3-Dibromo(1,2,3,4,5,6-13C6)benzene. Offered by: TRC. Available pack sizes: 10mg.
1,3-dibromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 1338070-96-4) is a chemical compound with the molecular formula C6H4Br2 and a molecular weight of 241.86 g/mol. IUPAC name: 1,3-dibromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: JSRLURSZEMLAFO-IDEBNGHGSA-N.
| Molecular formula | C6H4Br2 |
|---|---|
| Molecular weight | 241.86 g/mol |
| IUPAC name | 1,3-dibromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | JSRLURSZEMLAFO-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13C](=[13CH]1)Br)Br |
Computed by PubChem (NCBI)