CAS 4165-56-4 appears in our catalog under these names: 1,4-Dibromobenzene-d4, 99 atom % D, min 98% Chemical Purity, 1,4–Dibromobenzene–d4, Dibromobenzene-D4 99 atom % D, 1,4-DIBROMOBENZENE-D4, 98 ATOM % D, 1,4-Dibromobenzene-d4, 99.99%. Offered by: CDN, GLPBio, Deutero, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5g, 10g, 1g, 1 g, 10 g, 5 g.
1,4-dibromo-2,3,5,6-tetradeuteriobenzene (CAS 4165-56-4) is a chemical compound with the molecular formula C6H4Br2 and a molecular weight of 239.93 g/mol. IUPAC name: 1,4-dibromo-2,3,5,6-tetradeuteriobenzene. InChIKey: SWJPEBQEEAHIGZ-RHQRLBAQSA-N.
| Molecular formula | C6H4Br2 |
|---|---|
| Molecular weight | 239.93 g/mol |
| IUPAC name | 1,4-dibromo-2,3,5,6-tetradeuteriobenzene |
| InChIKey | SWJPEBQEEAHIGZ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Br)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)