CAS 1616983-07-3 appears in our catalog under these names: 4,6-Dibromobenzene-1,2,3,5-d4, 1,3-Dibromobenzene-d4, 99.95%. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 1 g, 100 mg, 250 mg, 500 mg, 5 g.
1,3-dibromo-2,4,5,6-tetradeuteriobenzene (CAS 1616983-07-3) is a chemical compound with the molecular formula C6H4Br2 and a molecular weight of 239.93 g/mol. IUPAC name: 1,3-dibromo-2,4,5,6-tetradeuteriobenzene. InChIKey: JSRLURSZEMLAFO-RHQRLBAQSA-N.
| Molecular formula | C6H4Br2 |
|---|---|
| Molecular weight | 239.93 g/mol |
| IUPAC name | 1,3-dibromo-2,4,5,6-tetradeuteriobenzene |
| InChIKey | JSRLURSZEMLAFO-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Br)[2H])Br)[2H] |
Computed by PubChem (NCBI)