Products 133833-93-9

CAS 133833-93-9 is the registry number for Ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate (CAS 133833-93-9) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate. InChIKey: XGTYLIJXUZQDJK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO3S
Molecular weight187.22 g/mol
IUPAC nameethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate
InChIKeyXGTYLIJXUZQDJK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=C(S1)C)O

Computed by PubChem (NCBI)