Products 1338332-27-6
CAS 1338332-27-6 is the registry number for Penicitide A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4R,6R)-4-hydroxy-6-[(5R,7S,10R)-10-hydroxy-5,7-dimethylundecyl]oxan-2-one (CAS 1338332-27-6) is a chemical compound with the molecular formula C18H34O4 and a molecular weight of 314.5 g/mol. IUPAC name: (4R,6R)-4-hydroxy-6-[(5R,7S,10R)-10-hydroxy-5,7-dimethylundecyl]oxan-2-one. InChIKey: ATWGXAMVMZHCKK-ZHCJQAHYSA-N.
| Molecular formula | C18H34O4 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (4R,6R)-4-hydroxy-6-[(5R,7S,10R)-10-hydroxy-5,7-dimethylundecyl]oxan-2-one |
| InChIKey | ATWGXAMVMZHCKK-ZHCJQAHYSA-N |
| SMILES | C[C@H](CCCC[C@@H]1C[C@H](CC(=O)O1)O)C[C@@H](C)CC[C@@H](C)O |
Computed by PubChem (NCBI)
Synonyms:
Penicitide A, orb1981982