Products 133841-12-0

CAS 133841-12-0 is the registry number for Benzyl 7-(Benzyloxy)-1-methyl-1H-indazole-3-carboxylate. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

Benzyl 1-methyl-7-phenylmethoxyindazole-3-carboxylate (CAS 133841-12-0) is a chemical compound with the molecular formula C23H20N2O3 and a molecular weight of 372.4 g/mol. IUPAC name: benzyl 1-methyl-7-phenylmethoxyindazole-3-carboxylate. InChIKey: DDQUTHBMNLJZRS-UHFFFAOYSA-N.

Identity
Molecular formulaC23H20N2O3
Molecular weight372.4 g/mol
IUPAC namebenzyl 1-methyl-7-phenylmethoxyindazole-3-carboxylate
InChIKeyDDQUTHBMNLJZRS-UHFFFAOYSA-N
SMILESCN1C2=C(C=CC=C2OCC3=CC=CC=C3)C(=N1)C(=O)OCC4=CC=CC=C4

Computed by PubChem (NCBI)