Products 356080-86-9
CAS 356080-86-9 is the registry number for 3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(2-phenylethyl)indol-2-one, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(2-phenylethyl)indol-2-one (CAS 356080-86-9) is a chemical compound with the molecular formula C23H20N2O3 and a molecular weight of 372.4 g/mol. IUPAC name: 3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(2-phenylethyl)indol-2-one. InChIKey: PKVCMYPBKGTNBM-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O3 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(2-phenylethyl)indol-2-one |
| InChIKey | PKVCMYPBKGTNBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C3=CC=CC=C3C(C2=O)(CC(=O)C4=CN=CC=C4)O |
Computed by PubChem (NCBI)