Products 36305-66-5
CAS 36305-66-5 is the registry number for 6-Methoxy-2,3-bis(4-methoxyphenyl)quinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
6-methoxy-2,3-bis(4-methoxyphenyl)quinoxaline (CAS 36305-66-5) is a chemical compound with the molecular formula C23H20N2O3 and a molecular weight of 372.4 g/mol. IUPAC name: 6-methoxy-2,3-bis(4-methoxyphenyl)quinoxaline. InChIKey: LULGFRBGWBEOTM-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O3 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 6-methoxy-2,3-bis(4-methoxyphenyl)quinoxaline |
| InChIKey | LULGFRBGWBEOTM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)OC)N=C2C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)