CAS 133865-32-4 appears in our catalog under these names: (S)-2-((4-(Benzyloxy)benzyl)amino)propanamide, 98%, Safinamide Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-[(4-phenylmethoxyphenyl)methylamino]propanamide (CAS 133865-32-4) is a chemical compound with the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. IUPAC name: (2S)-2-[(4-phenylmethoxyphenyl)methylamino]propanamide. InChIKey: IEHDKRBHKAGVKZ-ZDUSSCGKSA-N.
| Molecular formula | C17H20N2O2 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (2S)-2-[(4-phenylmethoxyphenyl)methylamino]propanamide |
| InChIKey | IEHDKRBHKAGVKZ-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C(=O)N)NCC1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)