Products 2055839-92-2
CAS 2055839-92-2 is the registry number for Cyclopropyl(naphthalen-1-yl)methanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Cyclopropyl(naphthalen-1-yl)methanone;hydrochloride (CAS 2055839-92-2) is a chemical compound with the molecular formula C14H13ClO and a molecular weight of 232.70 g/mol. IUPAC name: cyclopropyl(naphthalen-1-yl)methanone;hydrochloride. InChIKey: KJCXVNNMZKYOGK-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO |
|---|---|
| Molecular weight | 232.70 g/mol |
| IUPAC name | cyclopropyl(naphthalen-1-yl)methanone;hydrochloride |
| InChIKey | KJCXVNNMZKYOGK-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC=CC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)