Products 13391-39-4
CAS 13391-39-4 appears in our catalog under these names: Cetirizine Impurity 3, 1-Chloro-3-(chloro(phenyl)methyl)benzene. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 100g.
1-chloro-3-[chloro(phenyl)methyl]benzene (CAS 13391-39-4) is a chemical compound with the molecular formula C13H10Cl2 and a molecular weight of 237.12 g/mol. IUPAC name: 1-chloro-3-[chloro(phenyl)methyl]benzene. InChIKey: FCSFSWLSKOMQFX-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2 |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 1-chloro-3-[chloro(phenyl)methyl]benzene |
| InChIKey | FCSFSWLSKOMQFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)