CAS 64543-53-9 is the registry number for 4-Benzyl-1,2-dichlorobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-benzyl-1,2-dichlorobenzene (CAS 64543-53-9) is a chemical compound with the molecular formula C13H10Cl2 and a molecular weight of 237.12 g/mol. IUPAC name: 4-benzyl-1,2-dichlorobenzene. InChIKey: IVCOQBLSLHKQNP-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2 |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 4-benzyl-1,2-dichlorobenzene |
| InChIKey | IVCOQBLSLHKQNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)