Products 683816-27-5
CAS 683816-27-5 is the registry number for 3-(Dichloromethyl)-1,1'-biphenyl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(dichloromethyl)-3-phenylbenzene (CAS 683816-27-5) is a chemical compound with the molecular formula C13H10Cl2 and a molecular weight of 237.12 g/mol. IUPAC name: 1-(dichloromethyl)-3-phenylbenzene. InChIKey: SWBVXDBUZVGOML-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2 |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 1-(dichloromethyl)-3-phenylbenzene |
| InChIKey | SWBVXDBUZVGOML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C(Cl)Cl |
Computed by PubChem (NCBI)