CAS 1339174-14-9 appears in our catalog under these names: 2-Chloro-8-iodoquinoline, 98%, 2–Chloro–8–iodoquinoline, 2-Chloro-8-iodoquinoline, 98%, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-8-iodoquinoline (CAS 1339174-14-9) is a chemical compound with the molecular formula C9H5ClIN and a molecular weight of 289.50 g/mol. IUPAC name: 2-chloro-8-iodoquinoline. InChIKey: LAQBYEUQVRZPQK-UHFFFAOYSA-N.
| Molecular formula | C9H5ClIN |
|---|---|
| Molecular weight | 289.50 g/mol |
| IUPAC name | 2-chloro-8-iodoquinoline |
| InChIKey | LAQBYEUQVRZPQK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)N=C(C=C2)Cl |
Computed by PubChem (NCBI)