CAS 133929-18-7 appears in our catalog under these names: N1-(1H-Benzo(d)imidazol-2-yl)benzene-1,4-diamine, 97%, N1-(1H-1,3-Benzodiazol-2-yl)benzene-1,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-N-(1H-benzimidazol-2-yl)benzene-1,4-diamine (CAS 133929-18-7) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: 4-N-(1H-benzimidazol-2-yl)benzene-1,4-diamine. InChIKey: QTKVVJXYEASQLY-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 4-N-(1H-benzimidazol-2-yl)benzene-1,4-diamine |
| InChIKey | QTKVVJXYEASQLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)NC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)