Products 1339334-16-5
CAS 1339334-16-5 is the registry number for tert-Butyl N-(carbamimidoyl(cyclopropyl)methyl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-(2-amino-1-cyclopropyl-2-iminoethyl)carbamate (CAS 1339334-16-5) is a chemical compound with the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. IUPAC name: tert-butyl N-(2-amino-1-cyclopropyl-2-iminoethyl)carbamate. InChIKey: MKUXUJGTYKATFM-UHFFFAOYSA-N.
| Molecular formula | C10H19N3O2 |
|---|---|
| Molecular weight | 213.28 g/mol |
| IUPAC name | tert-butyl N-(2-amino-1-cyclopropyl-2-iminoethyl)carbamate |
| InChIKey | MKUXUJGTYKATFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1CC1)C(=N)N |
Computed by PubChem (NCBI)