Products 1339464-11-7

CAS 1339464-11-7 is the registry number for 9-Thia-2-azaspiro[5.5]undecane 9,9-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide (CAS 1339464-11-7) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: 9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide. InChIKey: FBJXEKXTTGBZBD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2S
Molecular weight203.30 g/mol
IUPAC name9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide
InChIKeyFBJXEKXTTGBZBD-UHFFFAOYSA-N
SMILESC1CC2(CCS(=O)(=O)CC2)CNC1

Computed by PubChem (NCBI)