CAS 1339464-11-7 is the registry number for 9-Thia-2-azaspiro[5.5]undecane 9,9-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide (CAS 1339464-11-7) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: 9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide. InChIKey: FBJXEKXTTGBZBD-UHFFFAOYSA-N.
| Molecular formula | C9H17NO2S |
|---|---|
| Molecular weight | 203.30 g/mol |
| IUPAC name | 9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide |
| InChIKey | FBJXEKXTTGBZBD-UHFFFAOYSA-N |
| SMILES | C1CC2(CCS(=O)(=O)CC2)CNC1 |
Computed by PubChem (NCBI)