CAS 1865069-43-7 is the registry number for 3-(2-(Cyclopropyl(methyl)amino)ethyl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(1,1-dioxothietan-3-yl)ethyl]-N-methylcyclopropanamine (CAS 1865069-43-7) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: N-[2-(1,1-dioxothietan-3-yl)ethyl]-N-methylcyclopropanamine. InChIKey: JNOIIQHDXSUZRZ-UHFFFAOYSA-N.
| Molecular formula | C9H17NO2S |
|---|---|
| Molecular weight | 203.30 g/mol |
| IUPAC name | N-[2-(1,1-dioxothietan-3-yl)ethyl]-N-methylcyclopropanamine |
| InChIKey | JNOIIQHDXSUZRZ-UHFFFAOYSA-N |
| SMILES | CN(CCC1CS(=O)(=O)C1)C2CC2 |
Computed by PubChem (NCBI)