CAS 1863950-23-5 is the registry number for 3-(((1-Methylcyclobutyl)methyl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1-methylcyclobutyl)methyl]-1,1-dioxothietan-3-amine (CAS 1863950-23-5) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: N-[(1-methylcyclobutyl)methyl]-1,1-dioxothietan-3-amine. InChIKey: TYNREPBJLBKRPR-UHFFFAOYSA-N.
| Molecular formula | C9H17NO2S |
|---|---|
| Molecular weight | 203.30 g/mol |
| IUPAC name | N-[(1-methylcyclobutyl)methyl]-1,1-dioxothietan-3-amine |
| InChIKey | TYNREPBJLBKRPR-UHFFFAOYSA-N |
| SMILES | CC1(CCC1)CNC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)