Products 1339471-09-8

CAS 1339471-09-8 is the registry number for Methyl 2-amino-3-(thiophen-3-yl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-thiophen-3-ylpropanoate (CAS 1339471-09-8) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: methyl 2-amino-3-thiophen-3-ylpropanoate. InChIKey: LOQJOEVPJCMGKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO2S
Molecular weight185.25 g/mol
IUPAC namemethyl 2-amino-3-thiophen-3-ylpropanoate
InChIKeyLOQJOEVPJCMGKJ-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CSC=C1)N

Computed by PubChem (NCBI)