Products 1339529-36-0
CAS 1339529-36-0 is the registry number for 1,3-Dimethyl-1H-pyrazolo(3,4-b)pyridine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,3-dimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid (CAS 1339529-36-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 1,3-dimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid. InChIKey: RMHVKUAVGSFBTE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 1,3-dimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid |
| InChIKey | RMHVKUAVGSFBTE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CC(=N2)C(=O)O)C |
Computed by PubChem (NCBI)