Products 1339688-25-3

CAS 1339688-25-3 is the registry number for 4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-bromobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-bromo-4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 1339688-25-3) is a chemical compound with the molecular formula C22H16BrNO4 and a molecular weight of 438.3 g/mol. IUPAC name: 3-bromo-4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: REWJFTWEGSFUEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16BrNO4
Molecular weight438.3 g/mol
IUPAC name3-bromo-4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid
InChIKeyREWJFTWEGSFUEZ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=C(C=C4)C(=O)O)Br

Computed by PubChem (NCBI)