CAS 183871-04-7 appears in our catalog under these names: Fmoc-2-amino-5-bromobenzoic acid, 95%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-bromobenzoic acid, 98%, Fmoc–2–amino–5–bromobenzoic acid, 2-(Fmoc-amino)-5-bromobenzoic acid, 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-5-bromobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 10g, 5g, 2,5g, 100mg.
5-bromo-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 183871-04-7) is a chemical compound with the molecular formula C22H16BrNO4 and a molecular weight of 438.3 g/mol. IUPAC name: 5-bromo-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: DJPIQOAAQHUHOB-UHFFFAOYSA-N.
| Molecular formula | C22H16BrNO4 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 5-bromo-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | DJPIQOAAQHUHOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=C(C=C4)Br)C(=O)O |
Computed by PubChem (NCBI)