CAS 443894-71-1 is the registry number for BRD-9327. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-bromobenzamide (CAS 443894-71-1) is a chemical compound with the molecular formula C22H16BrNO4 and a molecular weight of 438.3 g/mol. IUPAC name: N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-bromobenzamide. InChIKey: CDFCUHNJNPTGMX-UHFFFAOYSA-N.
| Molecular formula | C22H16BrNO4 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-bromobenzamide |
| InChIKey | CDFCUHNJNPTGMX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)NC(=O)C3=CC=CC=C3Br)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)