Products 133972-63-1
CAS 133972-63-1 appears in our catalog under these names: 2-(Phenylamino)-1,3-thiazole-5-carboxylic acid, 2-(Phenylamino)thiazole-5-carboxylic acid, 95%, 2-(PHENYLAMINO)-1,3-THIAZOLE-5-CARBOXYLIC ACID, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2-anilino-1,3-thiazole-5-carboxylic acid (CAS 133972-63-1) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 2-anilino-1,3-thiazole-5-carboxylic acid. InChIKey: JVDCBFYWWGXIRC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 2-anilino-1,3-thiazole-5-carboxylic acid |
| InChIKey | JVDCBFYWWGXIRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)