Products 134-72-5
CAS 134-72-5 appears in our catalog under these names: Ephedrine Sulphate, Ephedrine Sulphate 1.0 mg/ml in Methanol (as free base), (-)-Erythro-ephedrine sulfate. Offered by: Mikromol, LoGiCal, Biosynth. Available pack sizes: 250mg, 10mg, 1ml, 50mg, 25mg, 100mg.
Bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid (CAS 134-72-5) is a chemical compound with the molecular formula C20H32N2O6S and a molecular weight of 428.5 g/mol. IUPAC name: bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid. InChIKey: CAVQBDOACNULDN-KHFUBBAMSA-N.
| Molecular formula | C20H32N2O6S |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid |
| InChIKey | CAVQBDOACNULDN-KHFUBBAMSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)O)NC.C[C@@H]([C@@H](C1=CC=CC=C1)O)NC.OS(=O)(=O)O |
Computed by PubChem (NCBI)