Products 93918-98-0
CAS 93918-98-0 is the registry number for (1S,2R)-(+)-Ephedrine hemisulfate. Offered by: Biosynth. Available pack sizes: 1000mg.
Bis([(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium);sulfate (CAS 93918-98-0) is a chemical compound with the molecular formula C20H32N2O6S and a molecular weight of 428.5 g/mol. IUPAC name: bis([(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium);sulfate. InChIKey: CAVQBDOACNULDN-LMDBBIMRSA-N.
| Molecular formula | C20H32N2O6S |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | bis([(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium);sulfate |
| InChIKey | CAVQBDOACNULDN-LMDBBIMRSA-N |
| SMILES | C[C@H]([C@H](C1=CC=CC=C1)O)[NH2+]C.C[C@H]([C@H](C1=CC=CC=C1)O)[NH2+]C.[O-]S(=O)(=O)[O-] |
Computed by PubChem (NCBI)