Products 134002-17-8
CAS 134002-17-8 appears in our catalog under these names: D-Laserpitin, d-Laserpitin, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 5 mg, 1 mg, 5mg.
[(9S,10S)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate (CAS 134002-17-8) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: [(9S,10S)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate. InChIKey: QPLSCFLMIOADPA-LNUYWUECSA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | [(9S,10S)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | QPLSCFLMIOADPA-LNUYWUECSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@@H]1[C@@H](C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)O |
Computed by PubChem (NCBI)