Products 1340044-29-2
CAS 1340044-29-2 is the registry number for 2-(2-Amino-2-cyclopropylethyl)-1λâ¶,2-thiazolidine-1,1-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-cyclopropyl-2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethanamine (CAS 1340044-29-2) is a chemical compound with the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. IUPAC name: 1-cyclopropyl-2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethanamine. InChIKey: TUPPAPPNKIPVAK-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 1-cyclopropyl-2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethanamine |
| InChIKey | TUPPAPPNKIPVAK-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)CC(C2CC2)N |
Computed by PubChem (NCBI)