Products 13401-40-6
CAS 13401-40-6 appears in our catalog under these names: Phaseollin, Phaseollin, 98.0%, Phaseollin, min. 95 %, 1 mg. Offered by: Biosynth, MedChemExpress, Roth. Available pack sizes: 1mg, 1 mg, 5 mg.
(2R,11R)-17,17-dimethyl-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),5(10),6,8,14(19),15,20-heptaen-7-ol (CAS 13401-40-6) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: (2R,11R)-17,17-dimethyl-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),5(10),6,8,14(19),15,20-heptaen-7-ol. InChIKey: LWTDZKXXJRRKDG-KXBFYZLASA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (2R,11R)-17,17-dimethyl-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),5(10),6,8,14(19),15,20-heptaen-7-ol |
| InChIKey | LWTDZKXXJRRKDG-KXBFYZLASA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC3=C2O[C@@H]4[C@H]3COC5=C4C=CC(=C5)O)C |
Computed by PubChem (NCBI)