CAS 134015-93-3 is the registry number for Phenyl L-Z-Isoleucinamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
Benzyl N-[(2S,3S)-1-anilino-3-methyl-1-oxopentan-2-yl]carbamate (CAS 134015-93-3) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: benzyl N-[(2S,3S)-1-anilino-3-methyl-1-oxopentan-2-yl]carbamate. InChIKey: OYDMDVAWACLEQO-YJBOKZPZSA-N.
| Molecular formula | C20H24N2O3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | benzyl N-[(2S,3S)-1-anilino-3-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | OYDMDVAWACLEQO-YJBOKZPZSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)