Products 134015-93-3

CAS 134015-93-3 is the registry number for Phenyl L-Z-Isoleucinamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S,3S)-1-anilino-3-methyl-1-oxopentan-2-yl]carbamate (CAS 134015-93-3) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: benzyl N-[(2S,3S)-1-anilino-3-methyl-1-oxopentan-2-yl]carbamate. InChIKey: OYDMDVAWACLEQO-YJBOKZPZSA-N.

Identity
Molecular formulaC20H24N2O3
Molecular weight340.4 g/mol
IUPAC namebenzyl N-[(2S,3S)-1-anilino-3-methyl-1-oxopentan-2-yl]carbamate
InChIKeyOYDMDVAWACLEQO-YJBOKZPZSA-N
SMILESCC[C@H](C)[C@@H](C(=O)NC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)