CAS 60761-51-5 appears in our catalog under these names: (3R)-3-Hydroxy Quinidine, Quinine Impurity 2, (3R)-Hydroxyquinidine, >95% (HPLC), (3R)–hydroxy Quinidine, (3R)-Hydroxyquinidine. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg.
(3R,4S,6R)-3-ethenyl-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol (CAS 60761-51-5) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: (3R,4S,6R)-3-ethenyl-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol. InChIKey: BSRUJCFCZKMFMB-XVVDYKMHSA-N.
| Molecular formula | C20H24N2O3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (3R,4S,6R)-3-ethenyl-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-ol |
| InChIKey | BSRUJCFCZKMFMB-XVVDYKMHSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@@H]([C@H]3C[C@@H]4CCN3C[C@]4(C=C)O)O |
Computed by PubChem (NCBI)