Products 214475-40-8

CAS 214475-40-8 is the registry number for N-Propyl L-Z-Phenylalaninamide, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-oxo-3-phenyl-1-(propylamino)propan-2-yl]carbamate (CAS 214475-40-8) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: benzyl N-[(2S)-1-oxo-3-phenyl-1-(propylamino)propan-2-yl]carbamate. InChIKey: IOCKJFWSBACSJT-SFHVURJKSA-N.

Identity
Molecular formulaC20H24N2O3
Molecular weight340.4 g/mol
IUPAC namebenzyl N-[(2S)-1-oxo-3-phenyl-1-(propylamino)propan-2-yl]carbamate
InChIKeyIOCKJFWSBACSJT-SFHVURJKSA-N
SMILESCCCNC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)