CAS 1340481-90-4 is the registry number for tert–Butyl 8–hydroxy–5–thia–2–azaspiro(3·4)octane–2–carboxylate 5,5–dioxide. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl 8-hydroxy-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 1340481-90-4) is a chemical compound with the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. IUPAC name: tert-butyl 8-hydroxy-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: OJYOLQAIQYHQOC-UHFFFAOYSA-N.
| Molecular formula | C11H19NO5S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | tert-butyl 8-hydroxy-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | OJYOLQAIQYHQOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(CCS2(=O)=O)O |
Computed by PubChem (NCBI)