CAS 39218-17-2 appears in our catalog under these names: Neostigmine Impurity 8 Metilsulfate, Neostigmine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(3-methoxyphenyl)-trimethylazanium;methyl sulfate (CAS 39218-17-2) is a chemical compound with the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. IUPAC name: (3-methoxyphenyl)-trimethylazanium;methyl sulfate. InChIKey: KCCWIDPAXRHBAP-UHFFFAOYSA-M.
| Molecular formula | C11H19NO5S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | (3-methoxyphenyl)-trimethylazanium;methyl sulfate |
| InChIKey | KCCWIDPAXRHBAP-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1=CC(=CC=C1)OC.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)