CAS 2305255-06-3 is the registry number for tert-Butyl 7,7-dioxo-6-oxa-7λ6-thia-8-azaspiro(3.5)nonane-8-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 7,7-dioxo-6-oxa-7lambda6-thia-8-azaspiro[3.5]nonane-8-carboxylate (CAS 2305255-06-3) is a chemical compound with the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. IUPAC name: tert-butyl 7,7-dioxo-6-oxa-7lambda6-thia-8-azaspiro[3.5]nonane-8-carboxylate. InChIKey: GCTBLTUQDKZYNQ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO5S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | tert-butyl 7,7-dioxo-6-oxa-7lambda6-thia-8-azaspiro[3.5]nonane-8-carboxylate |
| InChIKey | GCTBLTUQDKZYNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCC2)COS1(=O)=O |
Computed by PubChem (NCBI)