CAS 1340481-91-5 appears in our catalog under these names: 5-Thia-2-azaspiro(3.4)octane-2-carboxylic acid, 8-oxo-, 1,1-dimethylethyl ester, 5,5-dioxide, 95-<97%, tert–Butyl 8–oxo–5–thia–2–azaspiro(3·4)octane–2–carboxylate 5,5–dioxide. Offered by: Hoffman Fine Chemicals, GLPBio. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2,5g.
Tert-butyl 5,5,8-trioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 1340481-91-5) is a chemical compound with the molecular formula C11H17NO5S and a molecular weight of 275.32 g/mol. IUPAC name: tert-butyl 5,5,8-trioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: YXFLECMRQFDZGN-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | tert-butyl 5,5,8-trioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | YXFLECMRQFDZGN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(=O)CCS2(=O)=O |
Computed by PubChem (NCBI)