CAS 146367-88-6 is the registry number for 4-Hydroxy-3-methoxymethamphetamine-4-O-sulfate. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg.
[2-methoxy-4-[2-(methylamino)propyl]phenyl] hydrogen sulfate (CAS 146367-88-6) is a chemical compound with the molecular formula C11H17NO5S and a molecular weight of 275.32 g/mol. IUPAC name: [2-methoxy-4-[2-(methylamino)propyl]phenyl] hydrogen sulfate. InChIKey: IYXSONOTJHQUFQ-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | [2-methoxy-4-[2-(methylamino)propyl]phenyl] hydrogen sulfate |
| InChIKey | IYXSONOTJHQUFQ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)OS(=O)(=O)O)OC)NC |
Computed by PubChem (NCBI)