Products 146367-88-6

CAS 146367-88-6 is the registry number for 4-Hydroxy-3-methoxymethamphetamine-4-O-sulfate. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

[2-methoxy-4-[2-(methylamino)propyl]phenyl] hydrogen sulfate (CAS 146367-88-6) is a chemical compound with the molecular formula C11H17NO5S and a molecular weight of 275.32 g/mol. IUPAC name: [2-methoxy-4-[2-(methylamino)propyl]phenyl] hydrogen sulfate. InChIKey: IYXSONOTJHQUFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO5S
Molecular weight275.32 g/mol
IUPAC name[2-methoxy-4-[2-(methylamino)propyl]phenyl] hydrogen sulfate
InChIKeyIYXSONOTJHQUFQ-UHFFFAOYSA-N
SMILESCC(CC1=CC(=C(C=C1)OS(=O)(=O)O)OC)NC

Computed by PubChem (NCBI)