Products 28177-45-9
CAS 28177-45-9 is the registry number for Adrenaline Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanesulfonic acid (CAS 28177-45-9) is a chemical compound with the molecular formula C11H17NO5S and a molecular weight of 275.32 g/mol. IUPAC name: 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanesulfonic acid. InChIKey: ZWPAWKMYYCYQQM-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanesulfonic acid |
| InChIKey | ZWPAWKMYYCYQQM-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC(=C(C=C1)O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)