Products 1340689-53-3
CAS 1340689-53-3 is the registry number for 2-[(3-Isopropylphenyl)amino]pyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3-propan-2-ylanilino)pyridine-3-sulfonamide (CAS 1340689-53-3) is a chemical compound with the molecular formula C14H17N3O2S and a molecular weight of 291.37 g/mol. IUPAC name: 2-(3-propan-2-ylanilino)pyridine-3-sulfonamide. InChIKey: CAKOXWDUTDKOLO-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | 2-(3-propan-2-ylanilino)pyridine-3-sulfonamide |
| InChIKey | CAKOXWDUTDKOLO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)NC2=C(C=CC=N2)S(=O)(=O)N |
Computed by PubChem (NCBI)