Products 1423155-03-6

CAS 1423155-03-6 appears in our catalog under these names: Fasudil Impurity 3, Fasudil Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-(1,4-diazepan-1-ylsulfonyl)quinoline (CAS 1423155-03-6) is a chemical compound with the molecular formula C14H17N3O2S and a molecular weight of 291.37 g/mol. IUPAC name: 8-(1,4-diazepan-1-ylsulfonyl)quinoline. InChIKey: DUSUMEJRHJKNJE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17N3O2S
Molecular weight291.37 g/mol
IUPAC name8-(1,4-diazepan-1-ylsulfonyl)quinoline
InChIKeyDUSUMEJRHJKNJE-UHFFFAOYSA-N
SMILESC1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2N=CC=C3

Computed by PubChem (NCBI)