CAS 1423155-03-6 appears in our catalog under these names: Fasudil Impurity 3, Fasudil Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
8-(1,4-diazepan-1-ylsulfonyl)quinoline (CAS 1423155-03-6) is a chemical compound with the molecular formula C14H17N3O2S and a molecular weight of 291.37 g/mol. IUPAC name: 8-(1,4-diazepan-1-ylsulfonyl)quinoline. InChIKey: DUSUMEJRHJKNJE-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | 8-(1,4-diazepan-1-ylsulfonyl)quinoline |
| InChIKey | DUSUMEJRHJKNJE-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2N=CC=C3 |
Computed by PubChem (NCBI)