CAS 1340737-22-5 is the registry number for 2-[(4-Ethoxyphenyl)amino]pyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-ethoxyanilino)pyridine-3-sulfonamide (CAS 1340737-22-5) is a chemical compound with the molecular formula C13H15N3O3S and a molecular weight of 293.34 g/mol. IUPAC name: 2-(4-ethoxyanilino)pyridine-3-sulfonamide. InChIKey: ROIMKJJOWYKKKL-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O3S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | 2-(4-ethoxyanilino)pyridine-3-sulfonamide |
| InChIKey | ROIMKJJOWYKKKL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=C(C=CC=N2)S(=O)(=O)N |
Computed by PubChem (NCBI)